C7H9N3O — CID 118607940
2,4,4a,8a-tetrahydro-1H-pyrido[3,4-b]pyrazin-3-one (PubChem CID 118607940) has the molecular formula C7H9N3O and a molecular weight of 151.17 g/mol. Its IUPAC name is 2,4,4a,8a-tetrahydro-1H-pyrido[3,4-b]pyrazin-3-one.
| Compound Name | 2,4,4a,8a-tetrahydro-1H-pyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 118607940 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 2,4,4a,8a-tetrahydro-1H-pyrido[3,4-b]pyrazin-3-one |
| SMILES | O=C1CNC2C=CN=CC2N1 |
| InChI | InChI=1S/C7H9N3O/c11-7-4-9-5-1-2-8-3-6(5)10-7/h1-3,5-6,9H,4H2,(H,10,11) |
| InChIKey | VBQOYLKYXSRAPB-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |