C20H24N4O4S — CID 118608404
4-[[(3R)-1,3-dimethyl-4-(oxan-4-yl)-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]benzenesulfinic acid (PubChem CID 118608404) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 4-[[(3R)-1,3-dimethyl-4-(oxan-4-yl)-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]benzenesulfinic acid.
| Compound Name | 4-[[(3R)-1,3-dimethyl-4-(oxan-4-yl)-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]benzenesulfinic acid |
|---|---|
| PubChem CID | 118608404 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[[(3R)-1,3-dimethyl-4-(oxan-4-yl)-2-oxo-3H-pyrido[2,3-b]pyrazin-6-yl]amino]benzenesulfinic acid |
| SMILES | C[C@@H]1C(=O)N(C)c2ccc(Nc3ccc(S(=O)O)cc3)nc2N1C1CCOCC1 |
| InChI | InChI=1S/C20H24N4O4S/c1-13-20(25)23(2)17-7-8-18(21-14-3-5-16(6-4-14)29(26)27)22-19(17)24(13)15-9-11-28-12-10-15/h3-8,13,15H,9-12H2,1-2H3,(H,21,22)(H,26,27)/t13-/m1/s1 |
| InChIKey | QTNFMUHRWGWHOK-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|