C17H17N3O4 — CID 118608761
2-[3-[5-[(1R)-1-methoxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]isoindole-1,3-dione (PubChem CID 118608761) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[3-[5-[(1R)-1-methoxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[5-[(1R)-1-methoxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118608761 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[3-[5-[(1R)-1-methoxyethyl]-1,3,4-oxadiazol-2-yl]cyclobutyl]isoindole-1,3-dione |
| SMILES | CO[C@H](C)c1nnc(C2CC(N3C(=O)c4ccccc4C3=O)C2)o1 |
| InChI | InChI=1S/C17H17N3O4/c1-9(23-2)14-18-19-15(24-14)10-7-11(8-10)20-16(21)12-5-3-4-6-13(12)17(20)22/h3-6,9-11H,7-8H2,1-2H3/t9-,10?,11?/m1/s1 |
| InChIKey | VAVSNSBCEOJMIO-KPPDAEKUSA-N |
| XLogP | 2.32 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|