C16H21NO8S2 — CID 11860885
dimethyl (4S,6S)-5-[4-(dimethylamino)phenyl]-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate (PubChem CID 11860885) has the molecular formula C16H21NO8S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is dimethyl (4S,6S)-5-[4-(dimethylamino)phenyl]-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate.
| Compound Name | dimethyl (4S,6S)-5-[4-(dimethylamino)phenyl]-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate |
|---|---|
| PubChem CID | 11860885 |
| Molecular Formula | C16H21NO8S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | dimethyl (4S,6S)-5-[4-(dimethylamino)phenyl]-1,1,3,3-tetraoxo-1,3-dithiane-4,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(c2ccc(N(C)C)cc2)[C@@H](C(=O)OC)S(=O)(=O)CS1(=O)=O |
| InChI | InChI=1S/C16H21NO8S2/c1-17(2)11-7-5-10(6-8-11)12-13(15(18)24-3)26(20,21)9-27(22,23)14(12)16(19)25-4/h5-8,12-14H,9H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | FGDWWVOFLSXSRT-KBPBESRZSA-N |
| XLogP | -0.28 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|