About 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide
2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide (PubChem CID 118609077) has the molecular formula C6H10O3S
and a molecular weight of 162.21 g/mol. Its IUPAC name is 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide.
Molecular Properties
| Compound Name | 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide |
| PubChem CID | 118609077 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide |
| SMILES | O=S1(=O)CCC2(COC2)C1 |
| InChI | InChI=1S/C6H10O3S/c7-10(8)2-1-6(5-10)3-9-4-6/h1-5H2 |
| InChIKey | BGSFAPIBCNTOLL-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide?
The IUPAC name of 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide (CID 118609077) is 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide.
What is the SMILES notation for 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide?
The canonical SMILES for 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide is O=S1(=O)CCC2(COC2)C1.
What is the InChIKey of 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide?
The InChIKey is BGSFAPIBCNTOLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3S/c7-10(8)2-1-6(5-10)3-9-4-6/h1-5H2.
What are the key properties of 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide?
2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide has a molecular weight of 162.21 g/mol, XLogP of -0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxa-6λ6-thiaspiro[3.4]octane 6,6-dioxide is sourced from PubChem (CID 118609077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).