C28H25BrN4S — CID 11860919
(1R,4R,4aS)-4-[5-[(4-bromophenyl)sulfanylmethyl]-2,4-dimethylphenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 11860919) has the molecular formula C28H25BrN4S and a molecular weight of 529.51 g/mol. Its IUPAC name is (1R,4R,4aS)-4-[5-[(4-bromophenyl)sulfanylmethyl]-2,4-dimethylphenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | (1R,4R,4aS)-4-[5-[(4-bromophenyl)sulfanylmethyl]-2,4-dimethylphenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 11860919 |
| Molecular Formula | C28H25BrN4S |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | (1R,4R,4aS)-4-[5-[(4-bromophenyl)sulfanylmethyl]-2,4-dimethylphenyl]-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@H](C#N)C2=CCCC[C@H]2[C@H](c2cc(CSc3ccc(Br)cc3)c(C)cc2C)C1(C#N)C#N |
| InChI | InChI=1S/C28H25BrN4S/c1-17-11-18(2)24(12-19(17)14-34-21-9-7-20(29)8-10-21)26-23-6-4-3-5-22(23)25(13-30)27(33)28(26,15-31)16-32/h5,7-12,23,25-26,33H,3-4,6,14H2,1-2H3/b33-27+/t23-,25-,26-/m1/s1 |
| InChIKey | AZVJUVVNKQHMHF-SQTUWLHSSA-N |
| XLogP | 7.38 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|