About methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate
methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate (PubChem CID 118609435) has the molecular formula C14H16N4O2S
and a molecular weight of 304.38 g/mol. Its IUPAC name is methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate |
| PubChem CID | 118609435 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(C2=CCCN(c3nccs3)C2)n(C)n1 |
| InChI | InChI=1S/C14H16N4O2S/c1-17-12(8-11(16-17)13(19)20-2)10-4-3-6-18(9-10)14-15-5-7-21-14/h4-5,7-8H,3,6,9H2,1-2H3 |
| InChIKey | XXODAOLOFAZDCH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate?
The IUPAC name of methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate (CID 118609435) is methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate.
What is the SMILES notation for methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate?
The canonical SMILES for methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate is COC(=O)c1cc(C2=CCCN(c3nccs3)C2)n(C)n1.
What is the InChIKey of methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate?
The InChIKey is XXODAOLOFAZDCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2S/c1-17-12(8-11(16-17)13(19)20-2)10-4-3-6-18(9-10)14-15-5-7-21-14/h4-5,7-8H,3,6,9H2,1-2H3.
What are the key properties of methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate?
methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate has a molecular weight of 304.38 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-methyl-5-[1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]pyrazole-3-carboxylate is sourced from PubChem (CID 118609435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).