C7H6N2O2 — CID 118609487
2,3-dihydroimidazo[1,5-a]pyridine-1,5-dione (PubChem CID 118609487) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 2,3-dihydroimidazo[1,5-a]pyridine-1,5-dione.
| Compound Name | 2,3-dihydroimidazo[1,5-a]pyridine-1,5-dione |
|---|---|
| PubChem CID | 118609487 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 2,3-dihydroimidazo[1,5-a]pyridine-1,5-dione |
| SMILES | O=C1NCn2c1cccc2=O |
| InChI | InChI=1S/C7H6N2O2/c10-6-3-1-2-5-7(11)8-4-9(5)6/h1-3H,4H2,(H,8,11) |
| InChIKey | SVFDVVWBABHQFV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |