About 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine
1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine (PubChem CID 118609510) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine |
| PubChem CID | 118609510 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine |
| SMILES | C1=CC2=C(C3CCCCC3)NCN2C=C1 |
| InChI | InChI=1S/C13H18N2/c1-2-6-11(7-3-1)13-12-8-4-5-9-15(12)10-14-13/h4-5,8-9,11,14H,1-3,6-7,10H2 |
| InChIKey | UZQGCFIVNUWBHK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine?
The IUPAC name of 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine (CID 118609510) is 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine.
What is the SMILES notation for 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine?
The canonical SMILES for 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine is C1=CC2=C(C3CCCCC3)NCN2C=C1.
What is the InChIKey of 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine?
The InChIKey is UZQGCFIVNUWBHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-2-6-11(7-3-1)13-12-8-4-5-9-15(12)10-14-13/h4-5,8-9,11,14H,1-3,6-7,10H2.
What are the key properties of 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine?
1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine has a molecular weight of 202.30 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,3-dihydroimidazo[1,5-a]pyridine is sourced from PubChem (CID 118609510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).