About 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one
10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one (PubChem CID 118609755) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one.
Molecular Properties
| Compound Name | 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one |
| PubChem CID | 118609755 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one |
| SMILES | CC1(C)C=CC2=C(C1)c1cccc(=O)n1CC2 |
| InChI | InChI=1S/C15H17NO/c1-15(2)8-6-11-7-9-16-13(12(11)10-15)4-3-5-14(16)17/h3-6,8H,7,9-10H2,1-2H3 |
| InChIKey | WOSKGZZXODTMPZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one?
The IUPAC name of 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one (CID 118609755) is 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one.
What is the SMILES notation for 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one?
The canonical SMILES for 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one is CC1(C)C=CC2=C(C1)c1cccc(=O)n1CC2.
What is the InChIKey of 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one?
The InChIKey is WOSKGZZXODTMPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO/c1-15(2)8-6-11-7-9-16-13(12(11)10-15)4-3-5-14(16)17/h3-6,8H,7,9-10H2,1-2H3.
What are the key properties of 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one?
10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one has a molecular weight of 227.31 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dimethyl-7,11-dihydro-6H-benzo[a]quinolizin-4-one is sourced from PubChem (CID 118609755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).