C13H22NO+ — CID 11861017
[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[[(2S)-oxolan-2-yl]methyl]azanium (PubChem CID 11861017) has the molecular formula C13H22NO+ and a molecular weight of 208.32 g/mol. Its IUPAC name is [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[[(2S)-oxolan-2-yl]methyl]azanium.
| Compound Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[[(2S)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 11861017 |
| Molecular Formula | C13H22NO+ |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | [(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl-[[(2S)-oxolan-2-yl]methyl]azanium |
| SMILES | C1=C[C@H]2C[C@@H]1C[C@@H]2C[NH2+]C[C@@H]1CCCO1 |
| InChI | InChI=1S/C13H21NO/c1-2-13(15-5-1)9-14-8-12-7-10-3-4-11(12)6-10/h3-4,10-14H,1-2,5-9H2/p+1/t10-,11+,12-,13+/m1/s1 |
| InChIKey | GKTMCVSDINGPBO-XQHKEYJVSA-O |
| XLogP | 0.94 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|