C13H11Br2NO2 — CID 118610215
3,5-dibromo-6-(4-methoxyphenyl)-1-methylpyridin-2-one (PubChem CID 118610215) has the molecular formula C13H11Br2NO2 and a molecular weight of 373.04 g/mol. Its IUPAC name is 3,5-dibromo-6-(4-methoxyphenyl)-1-methylpyridin-2-one.
| Compound Name | 3,5-dibromo-6-(4-methoxyphenyl)-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 118610215 |
| Molecular Formula | C13H11Br2NO2 |
| Molecular Weight | 373.04 g/mol |
| Exact Mass | 370.92 |
| IUPAC Name | 3,5-dibromo-6-(4-methoxyphenyl)-1-methylpyridin-2-one |
| SMILES | COc1ccc(-c2c(Br)cc(Br)c(=O)n2C)cc1 |
| InChI | InChI=1S/C13H11Br2NO2/c1-16-12(10(14)7-11(15)13(16)17)8-3-5-9(18-2)6-4-8/h3-7H,1-2H3 |
| InChIKey | ZKPMSEBRFPMRSR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.04 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |