About 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine
7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine (PubChem CID 118610608) has the molecular formula C18H18F2N4O3S
and a molecular weight of 408.43 g/mol. Its IUPAC name is 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine |
| PubChem CID | 118610608 |
| Molecular Formula | C18H18F2N4O3S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine |
| SMILES | Nc1[nH]c2c(OC3CCC(F)(F)CC3)ncnc2c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18F2N4O3S/c19-18(20)8-6-11(7-9-18)27-17-14-13(22-10-23-17)15(16(21)24-14)28(25,26)12-4-2-1-3-5-12/h1-5,10-11,24H,6-9,21H2 |
| InChIKey | MLBXXXCUJHZEBT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
The IUPAC name of 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine (CID 118610608) is 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine.
What is the SMILES notation for 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
The canonical SMILES for 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine is Nc1[nH]c2c(OC3CCC(F)(F)CC3)ncnc2c1S(=O)(=O)c1ccccc1.
What is the InChIKey of 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
The InChIKey is MLBXXXCUJHZEBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F2N4O3S/c19-18(20)8-6-11(7-9-18)27-17-14-13(22-10-23-17)15(16(21)24-14)28(25,26)12-4-2-1-3-5-12/h1-5,10-11,24H,6-9,21H2.
What are the key properties of 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine has a molecular weight of 408.43 g/mol, XLogP of 3.33, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(benzenesulfonyl)-4-(4,4-difluorocyclohexyl)oxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine is sourced from PubChem (CID 118610608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).