About 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine
7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine (PubChem CID 118610707) has the molecular formula C16H17FN4O3S
and a molecular weight of 364.40 g/mol. Its IUPAC name is 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine |
| PubChem CID | 118610707 |
| Molecular Formula | C16H17FN4O3S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine |
| SMILES | Cc1nc(OC(C)C)c2[nH]c(N)c(S(=O)(=O)c3ccccc3F)c2n1 |
| InChI | InChI=1S/C16H17FN4O3S/c1-8(2)24-16-13-12(19-9(3)20-16)14(15(18)21-13)25(22,23)11-7-5-4-6-10(11)17/h4-8,21H,18H2,1-3H3 |
| InChIKey | ZXVRJMPGGMIFMG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
The IUPAC name of 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine (CID 118610707) is 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine.
What is the SMILES notation for 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
The canonical SMILES for 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine is Cc1nc(OC(C)C)c2[nH]c(N)c(S(=O)(=O)c3ccccc3F)c2n1.
What is the InChIKey of 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
The InChIKey is ZXVRJMPGGMIFMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN4O3S/c1-8(2)24-16-13-12(19-9(3)20-16)14(15(18)21-13)25(22,23)11-7-5-4-6-10(11)17/h4-8,21H,18H2,1-3H3.
What are the key properties of 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine?
7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine has a molecular weight of 364.40 g/mol, XLogP of 2.61, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-fluorophenyl)sulfonyl-2-methyl-4-propan-2-yloxy-5H-pyrrolo[3,2-d]pyrimidin-6-amine is sourced from PubChem (CID 118610707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).