C15H15BrO2 — CID 118610840
(3Z)-3-[(4-bromo-2-methoxyphenyl)methylidene]bicyclo[2.2.1]heptan-2-one (PubChem CID 118610840) has the molecular formula C15H15BrO2 and a molecular weight of 307.19 g/mol. Its IUPAC name is (3Z)-3-[(4-bromo-2-methoxyphenyl)methylidene]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (3Z)-3-[(4-bromo-2-methoxyphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 118610840 |
| Molecular Formula | C15H15BrO2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (3Z)-3-[(4-bromo-2-methoxyphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
| SMILES | COc1cc(Br)ccc1/C=C1\C(=O)C2CCC1C2 |
| InChI | InChI=1S/C15H15BrO2/c1-18-14-8-12(16)5-4-10(14)7-13-9-2-3-11(6-9)15(13)17/h4-5,7-9,11H,2-3,6H2,1H3/b13-7- |
| InChIKey | LQKPJRAYFJOTQT-QPEQYQDCSA-N |
| XLogP | 3.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|