About 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid
2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid (PubChem CID 118610895) has the molecular formula C13H24O5
and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid.
Molecular Properties
| Compound Name | 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid |
| PubChem CID | 118610895 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid |
| SMILES | COC(CC(C)C)(C(=O)O)C(CC(C)C)C(=O)O |
| InChI | InChI=1S/C13H24O5/c1-8(2)6-10(11(14)15)13(18-5,12(16)17)7-9(3)4/h8-10H,6-7H2,1-5H3,(H,14,15)(H,16,17) |
| InChIKey | VHRIVMSHTYXGQW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid?
The IUPAC name of 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid (CID 118610895) is 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid.
What is the SMILES notation for 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid?
The canonical SMILES for 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid is COC(CC(C)C)(C(=O)O)C(CC(C)C)C(=O)O.
What is the InChIKey of 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid?
The InChIKey is VHRIVMSHTYXGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O5/c1-8(2)6-10(11(14)15)13(18-5,12(16)17)7-9(3)4/h8-10H,6-7H2,1-5H3,(H,14,15)(H,16,17).
What are the key properties of 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid?
2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid has a molecular weight of 260.33 g/mol, XLogP of 2.25, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2,3-bis(2-methylpropyl)butanedioic acid is sourced from PubChem (CID 118610895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).