C14H10ClN3OS — CID 118611402
4-[[5-(4-chlorophenyl)-1,2,4-thiadiazol-3-yl]amino]phenol (PubChem CID 118611402) has the molecular formula C14H10ClN3OS and a molecular weight of 303.77 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-1,2,4-thiadiazol-3-yl]amino]phenol.
| Compound Name | 4-[[5-(4-chlorophenyl)-1,2,4-thiadiazol-3-yl]amino]phenol |
|---|---|
| PubChem CID | 118611402 |
| Molecular Formula | C14H10ClN3OS |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-1,2,4-thiadiazol-3-yl]amino]phenol |
| SMILES | Oc1ccc(Nc2nsc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C14H10ClN3OS/c15-10-3-1-9(2-4-10)13-17-14(18-20-13)16-11-5-7-12(19)8-6-11/h1-8,19H,(H,16,18) |
| InChIKey | MLOJMIVJISPEDR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|