About 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one
3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one (PubChem CID 118611596) has the molecular formula C18H18N4O2
and a molecular weight of 322.37 g/mol. Its IUPAC name is 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one |
| PubChem CID | 118611596 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one |
| SMILES | Cc1ncc(-c2ccc3c(c2)N(c2[nH]ncc2C)C(=O)C3(C)C)o1 |
| InChI | InChI=1S/C18H18N4O2/c1-10-8-20-21-16(10)22-14-7-12(15-9-19-11(2)24-15)5-6-13(14)18(3,4)17(22)23/h5-9H,1-4H3,(H,20,21) |
| InChIKey | ZELXRNLJPJSBRF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one?
The IUPAC name of 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one (CID 118611596) is 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one.
What is the SMILES notation for 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one?
The canonical SMILES for 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one is Cc1ncc(-c2ccc3c(c2)N(c2[nH]ncc2C)C(=O)C3(C)C)o1.
What is the InChIKey of 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one?
The InChIKey is ZELXRNLJPJSBRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O2/c1-10-8-20-21-16(10)22-14-7-12(15-9-19-11(2)24-15)5-6-13(14)18(3,4)17(22)23/h5-9H,1-4H3,(H,20,21).
What are the key properties of 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one?
3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one has a molecular weight of 322.37 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-6-(2-methyl-1,3-oxazol-5-yl)-1-(4-methyl-1H-pyrazol-5-yl)indol-2-one is sourced from PubChem (CID 118611596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).