C25H34O3 — CID 118611629
(3aS,6E,10E,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one;2,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 118611629) has the molecular formula C25H34O3 and a molecular weight of 382.54 g/mol. Its IUPAC name is (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one;2,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one;2,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 118611629 |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.54 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one;2,6,6-trimethylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\C)CC[C@@H]12.CC1=C(C=O)C(C)(C)CC=C1 |
| InChI | InChI=1S/C15H20O2.C10H14O/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14;1-8-5-4-6-10(2,3)9(8)7-11/h5,9,13-14H,3-4,6-8H2,1-2H3;4-5,7H,6H2,1-3H3/b10-5+,11-9+;/t13-,14+;/m0./s1 |
| InChIKey | ZALLXYNFJXETCM-VPHIEZHPSA-N |
| XLogP | 6.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|