C22H35N3O+2 — CID 11861198
diethyl-[(2R)-2-hydroxy-3-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propyl]azanium (PubChem CID 11861198) has the molecular formula C22H35N3O+2 and a molecular weight of 357.54 g/mol. Its IUPAC name is diethyl-[(2R)-2-hydroxy-3-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propyl]azanium.
| Compound Name | diethyl-[(2R)-2-hydroxy-3-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propyl]azanium |
|---|---|
| PubChem CID | 11861198 |
| Molecular Formula | C22H35N3O+2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | diethyl-[(2R)-2-hydroxy-3-[(5S)-12-methyl-1-aza-4-azoniatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraen-4-yl]propyl]azanium |
| SMILES | CC[NH+](CC)C[C@@H](O)C[NH+]1CCn2c3c(c4cc(C)ccc42)CCC[C@@H]31 |
| InChI | InChI=1S/C22H33N3O/c1-4-23(5-2)14-17(26)15-24-11-12-25-20-10-9-16(3)13-19(20)18-7-6-8-21(24)22(18)25/h9-10,13,17,21,26H,4-8,11-12,14-15H2,1-3H3/p+2/t17-,21+/m1/s1 |
| InChIKey | NHQPDZJOVULUOU-UTKZUKDTSA-P |
| XLogP | 0.51 |
| TPSA | 34.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|