About N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide
N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide (PubChem CID 118612266) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide.
Molecular Properties
| Compound Name | N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide |
| PubChem CID | 118612266 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide |
| SMILES | C=C/C(=C\C=C(C)C)NC(=O)CC |
| InChI | InChI=1S/C11H17NO/c1-5-10(8-7-9(3)4)12-11(13)6-2/h5,7-8H,1,6H2,2-4H3,(H,12,13)/b10-8+ |
| InChIKey | JUIQTWREAJFXGQ-CSKARUKUSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide?
The IUPAC name of N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide (CID 118612266) is N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide.
What is the SMILES notation for N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide?
The canonical SMILES for N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide is C=C/C(=C\C=C(C)C)NC(=O)CC.
What is the InChIKey of N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide?
The InChIKey is JUIQTWREAJFXGQ-CSKARUKUSA-N. The full InChI is InChI=1S/C11H17NO/c1-5-10(8-7-9(3)4)12-11(13)6-2/h5,7-8H,1,6H2,2-4H3,(H,12,13)/b10-8+.
What are the key properties of N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide?
N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide has a molecular weight of 179.26 g/mol, XLogP of 2.55, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]propanamide is sourced from PubChem (CID 118612266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).