About 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide
6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide (PubChem CID 118612958) has the molecular formula C16H19N3O3S
and a molecular weight of 333.41 g/mol. Its IUPAC name is 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide |
| PubChem CID | 118612958 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide |
| SMILES | Cc1cc(OCC2CCCO2)cc(C(=O)Nc2nc(C)cs2)n1 |
| InChI | InChI=1S/C16H19N3O3S/c1-10-6-13(22-8-12-4-3-5-21-12)7-14(17-10)15(20)19-16-18-11(2)9-23-16/h6-7,9,12H,3-5,8H2,1-2H3,(H,18,19,20) |
| InChIKey | WIJPENARPNXJLF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide?
The IUPAC name of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide (CID 118612958) is 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide.
What is the SMILES notation for 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide?
The canonical SMILES for 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide is Cc1cc(OCC2CCCO2)cc(C(=O)Nc2nc(C)cs2)n1.
What is the InChIKey of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide?
The InChIKey is WIJPENARPNXJLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3S/c1-10-6-13(22-8-12-4-3-5-21-12)7-14(17-10)15(20)19-16-18-11(2)9-23-16/h6-7,9,12H,3-5,8H2,1-2H3,(H,18,19,20).
What are the key properties of 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide?
6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide has a molecular weight of 333.41 g/mol, XLogP of 2.97, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-N-(4-methyl-1,3-thiazol-2-yl)-4-(oxolan-2-ylmethoxy)pyridine-2-carboxamide is sourced from PubChem (CID 118612958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).