About 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan
3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan (PubChem CID 118613005) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan.
Analyze 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan?
The IUPAC name of 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan (CID 118613005) is 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan.
What is the SMILES notation for 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan?
The canonical SMILES for 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan is CC(C)C1COC2COCC21.
What is the InChIKey of 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan?
The InChIKey is OIJNOPALWDCCBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-6(2)7-4-11-9-5-10-3-8(7)9/h6-9H,3-5H2,1-2H3.
What are the key properties of 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan?
3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan has a molecular weight of 156.22 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]furan is sourced from PubChem (CID 118613005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).