C9H16O3S — CID 118613128
6-propan-2-yl-2,3,3a,5,6,6a-hexahydrothieno[3,2-b]furan 4,4-dioxide (PubChem CID 118613128) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 6-propan-2-yl-2,3,3a,5,6,6a-hexahydrothieno[3,2-b]furan 4,4-dioxide.
| Compound Name | 6-propan-2-yl-2,3,3a,5,6,6a-hexahydrothieno[3,2-b]furan 4,4-dioxide |
|---|---|
| PubChem CID | 118613128 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 6-propan-2-yl-2,3,3a,5,6,6a-hexahydrothieno[3,2-b]furan 4,4-dioxide |
| SMILES | CC(C)C1CS(=O)(=O)C2CCOC12 |
| InChI | InChI=1S/C9H16O3S/c1-6(2)7-5-13(10,11)8-3-4-12-9(7)8/h6-9H,3-5H2,1-2H3 |
| InChIKey | VBATUEPRKSXXBK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |