C27H36N4O2 — CID 118613614
2-(5-methylfuran-2-yl)-N-(1-methylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine (PubChem CID 118613614) has the molecular formula C27H36N4O2 and a molecular weight of 448.61 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-N-(1-methylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine.
| Compound Name | 2-(5-methylfuran-2-yl)-N-(1-methylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine |
|---|---|
| PubChem CID | 118613614 |
| Molecular Formula | C27H36N4O2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-N-(1-methylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-amine |
| SMILES | Cc1ccc(-c2cc(NC3CCN(C)CC3)c3ccc(OCCCN4CCCC4)cc3n2)o1 |
| InChI | InChI=1S/C27H36N4O2/c1-20-6-9-27(33-20)26-19-25(28-21-10-15-30(2)16-11-21)23-8-7-22(18-24(23)29-26)32-17-5-14-31-12-3-4-13-31/h6-9,18-19,21H,3-5,10-17H2,1-2H3,(H,28,29) |
| InChIKey | UWTQREDSTMKGMT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|