C20H27N5O4S3 — CID 118613747
(5R,8S,11S)-8-(2-aminoethyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione (PubChem CID 118613747) has the molecular formula C20H27N5O4S3 and a molecular weight of 497.67 g/mol. Its IUPAC name is (5R,8S,11S)-8-(2-aminoethyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione.
| Compound Name | (5R,8S,11S)-8-(2-aminoethyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
|---|---|
| PubChem CID | 118613747 |
| Molecular Formula | C20H27N5O4S3 |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | (5R,8S,11S)-8-(2-aminoethyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
| SMILES | C[C@@]12CSC(=N1)c1csc(n1)CNC(=O)C[C@@H](/C=C/CCS)OC(=O)[C@H](CCN)NC2=O |
| InChI | InChI=1S/C20H27N5O4S3/c1-20-11-32-17(25-20)14-10-31-16(23-14)9-22-15(26)8-12(4-2-3-7-30)29-18(27)13(5-6-21)24-19(20)28/h2,4,10,12-13,30H,3,5-9,11,21H2,1H3,(H,22,26)(H,24,28)/b4-2+/t12-,13+,20+/m1/s1 |
| InChIKey | UPHGDUASWFHVLG-CMAFZDKKSA-N |
| XLogP | 1.04 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|