C20H24N4O6S3 — CID 118613750
2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]acetic acid (PubChem CID 118613750) has the molecular formula C20H24N4O6S3 and a molecular weight of 512.64 g/mol. Its IUPAC name is 2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]acetic acid.
| Compound Name | 2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]acetic acid |
|---|---|
| PubChem CID | 118613750 |
| Molecular Formula | C20H24N4O6S3 |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]acetic acid |
| SMILES | C[C@@]12CSC(=N1)c1csc(n1)CNC(=O)C[C@@H](/C=C/CCS)OC(=O)[C@H](CC(=O)O)NC2=O |
| InChI | InChI=1S/C20H24N4O6S3/c1-20-10-33-17(24-20)13-9-32-15(22-13)8-21-14(25)6-11(4-2-3-5-31)30-18(28)12(7-16(26)27)23-19(20)29/h2,4,9,11-12,31H,3,5-8,10H2,1H3,(H,21,25)(H,23,29)(H,26,27)/b4-2+/t11-,12+,20+/m1/s1 |
| InChIKey | MWFOONMNVBPVQC-IRUIRIKDSA-N |
| XLogP | 1.16 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|