C25H35N5O6S3 — CID 118613751
tert-butyl N-[2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]ethyl]carbamate (PubChem CID 118613751) has the molecular formula C25H35N5O6S3 and a molecular weight of 597.79 g/mol. Its IUPAC name is tert-butyl N-[2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 118613751 |
| Molecular Formula | C25H35N5O6S3 |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | tert-butyl N-[2-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-8-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC[C@@H]1NC(=O)[C@]2(C)CSC(=N2)c2csc(n2)CNC(=O)C[C@@H](/C=C/CCS)OC1=O |
| InChI | InChI=1S/C25H35N5O6S3/c1-24(2,3)36-23(34)26-9-8-16-21(32)35-15(7-5-6-10-37)11-18(31)27-12-19-28-17(13-38-19)20-30-25(4,14-39-20)22(33)29-16/h5,7,13,15-16,37H,6,8-12,14H2,1-4H3,(H,26,34)(H,27,31)(H,29,33)/b7-5+/t15-,16+,25+/m1/s1 |
| InChIKey | GWEVPILGTKKVAZ-QGKFPQEJSA-N |
| XLogP | 2.60 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|