C21H29N5O4S3 — CID 118613756
(5R,8S,11S)-8-(3-aminopropyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione (PubChem CID 118613756) has the molecular formula C21H29N5O4S3 and a molecular weight of 511.70 g/mol. Its IUPAC name is (5R,8S,11S)-8-(3-aminopropyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione.
| Compound Name | (5R,8S,11S)-8-(3-aminopropyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
|---|---|
| PubChem CID | 118613756 |
| Molecular Formula | C21H29N5O4S3 |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | (5R,8S,11S)-8-(3-aminopropyl)-5-methyl-11-[(E)-4-sulfanylbut-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
| SMILES | C[C@@]12CSC(=N1)c1csc(n1)CNC(=O)C[C@@H](/C=C/CCS)OC(=O)[C@H](CCCN)NC2=O |
| InChI | InChI=1S/C21H29N5O4S3/c1-21-12-33-18(26-21)15-11-32-17(24-15)10-23-16(27)9-13(5-2-3-8-31)30-19(28)14(6-4-7-22)25-20(21)29/h2,5,11,13-14,31H,3-4,6-10,12,22H2,1H3,(H,23,27)(H,25,29)/b5-2+/t13-,14+,21+/m1/s1 |
| InChIKey | CMRYZGNLUGDJIV-XZKJIUSUSA-N |
| XLogP | 1.43 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|