C16H15N5O2 — CID 118613761
10-methyl-4-(pyrimidin-4-ylamino)-2,9-diazatetracyclo[7.4.0.01,10.02,7]trideca-4,6-diene-3,8-dione (PubChem CID 118613761) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 10-methyl-4-(pyrimidin-4-ylamino)-2,9-diazatetracyclo[7.4.0.01,10.02,7]trideca-4,6-diene-3,8-dione.
| Compound Name | 10-methyl-4-(pyrimidin-4-ylamino)-2,9-diazatetracyclo[7.4.0.01,10.02,7]trideca-4,6-diene-3,8-dione |
|---|---|
| PubChem CID | 118613761 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 10-methyl-4-(pyrimidin-4-ylamino)-2,9-diazatetracyclo[7.4.0.01,10.02,7]trideca-4,6-diene-3,8-dione |
| SMILES | CC12CCCC13N2C(=O)c1ccc(Nc2ccncn2)c(=O)n13 |
| InChI | InChI=1S/C16H15N5O2/c1-15-6-2-7-16(15)20-11(14(23)21(15)16)4-3-10(13(20)22)19-12-5-8-17-9-18-12/h3-5,8-9H,2,6-7H2,1H3,(H,17,18,19) |
| InChIKey | PVPIZJMJXBBGDD-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|