C18H18F6N4O3S — CID 118613771
(2R,3S,5R,6S)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)-2-(2,4,5-trifluorophenyl)oxan-3-amine (PubChem CID 118613771) has the molecular formula C18H18F6N4O3S and a molecular weight of 484.42 g/mol. Its IUPAC name is (2R,3S,5R,6S)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)-2-(2,4,5-trifluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R,6S)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 118613771 |
| Molecular Formula | C18H18F6N4O3S |
| Molecular Weight | 484.42 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (2R,3S,5R,6S)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-6-(trifluoromethyl)-2-(2,4,5-trifluorophenyl)oxan-3-amine |
| SMILES | CS(=O)(=O)n1cc2c(n1)CN([C@@H]1C[C@H](N)[C@@H](c3cc(F)c(F)cc3F)O[C@@H]1C(F)(F)F)C2 |
| InChI | InChI=1S/C18H18F6N4O3S/c1-32(29,30)28-6-8-5-27(7-14(8)26-28)15-4-13(25)16(31-17(15)18(22,23)24)9-2-11(20)12(21)3-10(9)19/h2-3,6,13,15-17H,4-5,7,25H2,1H3/t13-,15+,16+,17-/m0/s1 |
| InChIKey | NIVAGONUJKAVTN-SVGFKBNWSA-N |
| XLogP | 2.21 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|