About 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole
3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole (PubChem CID 118613951) has the molecular formula C8H11N7
and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole.
Molecular Properties
| Compound Name | 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole |
| PubChem CID | 118613951 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole |
| SMILES | Cn1nnnc1-c1nc2c(n1C)CNC2 |
| InChI | InChI=1S/C8H11N7/c1-14-6-4-9-3-5(6)10-7(14)8-11-12-13-15(8)2/h9H,3-4H2,1-2H3 |
| InChIKey | QURHKJIKRHVMAZ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
The IUPAC name of 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole (CID 118613951) is 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole.
What is the SMILES notation for 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
The canonical SMILES for 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole is Cn1nnnc1-c1nc2c(n1C)CNC2.
What is the InChIKey of 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
The InChIKey is QURHKJIKRHVMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N7/c1-14-6-4-9-3-5(6)10-7(14)8-11-12-13-15(8)2/h9H,3-4H2,1-2H3.
What are the key properties of 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole has a molecular weight of 205.22 g/mol, XLogP of -0.79, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(1-methyltetrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole is sourced from PubChem (CID 118613951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).