About 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole
3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole (PubChem CID 118614122) has the molecular formula C10H13N5
and a molecular weight of 203.25 g/mol. Its IUPAC name is 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole.
Molecular Properties
| Compound Name | 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole |
| PubChem CID | 118614122 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole |
| SMILES | CCn1c(-c2ccn[nH]2)nc2c1CNC2 |
| InChI | InChI=1S/C10H13N5/c1-2-15-9-6-11-5-8(9)13-10(15)7-3-4-12-14-7/h3-4,11H,2,5-6H2,1H3,(H,12,14) |
| InChIKey | OGJLSUXNLLDJTA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
The IUPAC name of 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole (CID 118614122) is 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole.
What is the SMILES notation for 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
The canonical SMILES for 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole is CCn1c(-c2ccn[nH]2)nc2c1CNC2.
What is the InChIKey of 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
The InChIKey is OGJLSUXNLLDJTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5/c1-2-15-9-6-11-5-8(9)13-10(15)7-3-4-12-14-7/h3-4,11H,2,5-6H2,1H3,(H,12,14).
What are the key properties of 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole?
3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole has a molecular weight of 203.25 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-(1H-pyrazol-5-yl)-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole is sourced from PubChem (CID 118614122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).