C22H26F2N6O — CID 118614123
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-ethyl-2-(1H-pyrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-N-methyloxan-3-amine (PubChem CID 118614123) has the molecular formula C22H26F2N6O and a molecular weight of 428.49 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-ethyl-2-(1H-pyrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-N-methyloxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-ethyl-2-(1H-pyrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-N-methyloxan-3-amine |
|---|---|
| PubChem CID | 118614123 |
| Molecular Formula | C22H26F2N6O |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-[3-ethyl-2-(1H-pyrazol-5-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-N-methyloxan-3-amine |
| SMILES | CCn1c(-c2ccn[nH]2)nc2c1CN([C@H]1CO[C@H](c3cc(F)ccc3F)[C@@H](NC)C1)C2 |
| InChI | InChI=1S/C22H26F2N6O/c1-3-30-20-11-29(10-19(20)27-22(30)17-6-7-26-28-17)14-9-18(25-2)21(31-12-14)15-8-13(23)4-5-16(15)24/h4-8,14,18,21,25H,3,9-12H2,1-2H3,(H,26,28)/t14-,18+,21-/m1/s1 |
| InChIKey | YNFYILSLLUUJCW-YMTYPPQLSA-N |
| XLogP | 3.01 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |