C21H22F4N6O — CID 118614355
(2R,3S,5R)-5-[3-(difluoromethyl)-2-(1-methylpyrazol-3-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine (PubChem CID 118614355) has the molecular formula C21H22F4N6O and a molecular weight of 450.44 g/mol. Its IUPAC name is (2R,3S,5R)-5-[3-(difluoromethyl)-2-(1-methylpyrazol-3-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-5-[3-(difluoromethyl)-2-(1-methylpyrazol-3-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
|---|---|
| PubChem CID | 118614355 |
| Molecular Formula | C21H22F4N6O |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (2R,3S,5R)-5-[3-(difluoromethyl)-2-(1-methylpyrazol-3-yl)-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-amine |
| SMILES | Cn1ccc(-c2nc3c(n2C(F)F)CN([C@H]2CO[C@H](c4cc(F)ccc4F)[C@@H](N)C2)C3)n1 |
| InChI | InChI=1S/C21H22F4N6O/c1-29-5-4-16(28-29)20-27-17-8-30(9-18(17)31(20)21(24)25)12-7-15(26)19(32-10-12)13-6-11(22)2-3-14(13)23/h2-6,12,15,19,21H,7-10,26H2,1H3/t12-,15+,19-/m1/s1 |
| InChIKey | HIJSPLBEQXJKLY-XFHNUULXSA-N |
| XLogP | 3.13 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |