About 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide
3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide (PubChem CID 118614452) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide |
| PubChem CID | 118614452 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide |
| SMILES | CCn1c(C(N)=O)nc2c1CNC2 |
| InChI | InChI=1S/C8H12N4O/c1-2-12-6-4-10-3-5(6)11-8(12)7(9)13/h10H,2-4H2,1H3,(H2,9,13) |
| InChIKey | TUBKCLIKXXKXBN-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide?
The IUPAC name of 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide (CID 118614452) is 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide.
What is the SMILES notation for 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide?
The canonical SMILES for 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide is CCn1c(C(N)=O)nc2c1CNC2.
What is the InChIKey of 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide?
The InChIKey is TUBKCLIKXXKXBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-2-12-6-4-10-3-5(6)11-8(12)7(9)13/h10H,2-4H2,1H3,(H2,9,13).
What are the key properties of 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide?
3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide has a molecular weight of 180.21 g/mol, XLogP of -0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,6-dihydro-4H-pyrrolo[3,4-d]imidazole-2-carboxamide is sourced from PubChem (CID 118614452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).