C21H30O11 — CID 118614605
[(1R,2R,5S,6R,7S,9S,10R,12R)-12-acetyl-9-acetyloxy-1,5,6-trihydroxy-5,9-dimethyl-4-oxo-3,13-dioxatricyclo[8.3.0.02,6]tridecan-7-yl] butanoate (PubChem CID 118614605) has the molecular formula C21H30O11 and a molecular weight of 458.46 g/mol. Its IUPAC name is [(1R,2R,5S,6R,7S,9S,10R,12R)-12-acetyl-9-acetyloxy-1,5,6-trihydroxy-5,9-dimethyl-4-oxo-3,13-dioxatricyclo[8.3.0.02,6]tridecan-7-yl] butanoate.
| Compound Name | [(1R,2R,5S,6R,7S,9S,10R,12R)-12-acetyl-9-acetyloxy-1,5,6-trihydroxy-5,9-dimethyl-4-oxo-3,13-dioxatricyclo[8.3.0.02,6]tridecan-7-yl] butanoate |
|---|---|
| PubChem CID | 118614605 |
| Molecular Formula | C21H30O11 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | [(1R,2R,5S,6R,7S,9S,10R,12R)-12-acetyl-9-acetyloxy-1,5,6-trihydroxy-5,9-dimethyl-4-oxo-3,13-dioxatricyclo[8.3.0.02,6]tridecan-7-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@](C)(OC(C)=O)[C@H]2C[C@H](C(C)=O)O[C@@]2(O)[C@@H]2OC(=O)[C@@](C)(O)[C@@]12O |
| InChI | InChI=1S/C21H30O11/c1-6-7-15(24)29-14-9-18(4,31-11(3)23)13-8-12(10(2)22)32-21(13,28)16-20(14,27)19(5,26)17(25)30-16/h12-14,16,26-28H,6-9H2,1-5H3/t12-,13-,14+,16-,18+,19-,20-,21-/m1/s1 |
| InChIKey | IKSKCMLXFUAUNU-MWSIBWBVSA-N |
| XLogP | -0.49 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|