About 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine
5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine (PubChem CID 118614865) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine.
Molecular Properties
| Compound Name | 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine |
| PubChem CID | 118614865 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine |
| SMILES | C/C=C/C(=C\C)c1c(N)n[nH]c1CC |
| InChI | InChI=1S/C11H17N3/c1-4-7-8(5-2)10-9(6-3)13-14-11(10)12/h4-5,7H,6H2,1-3H3,(H3,12,13,14)/b7-4+,8-5+ |
| InChIKey | HLUMSUPJHPUTAP-NSLJXJERSA-N |
| XLogP | 2.53 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine?
The IUPAC name of 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine (CID 118614865) is 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine.
What is the SMILES notation for 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine?
The canonical SMILES for 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine is C/C=C/C(=C\C)c1c(N)n[nH]c1CC.
What is the InChIKey of 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine?
The InChIKey is HLUMSUPJHPUTAP-NSLJXJERSA-N. The full InChI is InChI=1S/C11H17N3/c1-4-7-8(5-2)10-9(6-3)13-14-11(10)12/h4-5,7H,6H2,1-3H3,(H3,12,13,14)/b7-4+,8-5+.
What are the key properties of 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine?
5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine has a molecular weight of 191.28 g/mol, XLogP of 2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4-[(2E,4E)-hexa-2,4-dien-3-yl]-1H-pyrazol-3-amine is sourced from PubChem (CID 118614865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).