About [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene
[(3Z)-4-methylhexa-3,5-dien-3-yl]diazene (PubChem CID 118614915) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene.
Molecular Properties
| Compound Name | [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene |
| PubChem CID | 118614915 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene |
| SMILES | [H]/N=N/C(CC)=C(/C)C=C |
| InChI | InChI=1S/C7H12N2/c1-4-6(3)7(5-2)9-8/h4,8H,1,5H2,2-3H3/b7-6-,9-8+ |
| InChIKey | RABDEGIFBJSTMU-NMMTYZSQSA-N |
| XLogP | 2.89 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene?
The IUPAC name of [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene (CID 118614915) is [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene.
What is the SMILES notation for [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene?
The canonical SMILES for [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene is [H]/N=N/C(CC)=C(/C)C=C.
What is the InChIKey of [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene?
The InChIKey is RABDEGIFBJSTMU-NMMTYZSQSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-6(3)7(5-2)9-8/h4,8H,1,5H2,2-3H3/b7-6-,9-8+.
What are the key properties of [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene?
[(3Z)-4-methylhexa-3,5-dien-3-yl]diazene has a molecular weight of 124.19 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-4-methylhexa-3,5-dien-3-yl]diazene is sourced from PubChem (CID 118614915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).