C16H13F4N3O6S — CID 118614985
(2R)-3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methyl-N-[5-nitro-4-(trifluoromethyl)-2-pyridinyl]propanamide (PubChem CID 118614985) has the molecular formula C16H13F4N3O6S and a molecular weight of 451.35 g/mol. Its IUPAC name is (2R)-3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methyl-N-[5-nitro-4-(trifluoromethyl)-2-pyridinyl]propanamide.
| Compound Name | (2R)-3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methyl-N-[5-nitro-4-(trifluoromethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 118614985 |
| Molecular Formula | C16H13F4N3O6S |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | (2R)-3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methyl-N-[5-nitro-4-(trifluoromethyl)-2-pyridinyl]propanamide |
| SMILES | C[C@](O)(CS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1cc(C(F)(F)F)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C16H13F4N3O6S/c1-15(25,8-30(28,29)10-4-2-9(17)3-5-10)14(24)22-13-6-11(16(18,19)20)12(7-21-13)23(26)27/h2-7,25H,8H2,1H3,(H,21,22,24)/t15-/m0/s1 |
| InChIKey | XJRBJUPBKRUUCW-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|