C13H24NO+ — CID 11861513
(1R,2S,5S,8S)-2-piperidin-1-ium-1-ylbicyclo[3.2.1]octan-8-ol (PubChem CID 11861513) has the molecular formula C13H24NO+ and a molecular weight of 210.34 g/mol. Its IUPAC name is (1R,2S,5S,8S)-2-piperidin-1-ium-1-ylbicyclo[3.2.1]octan-8-ol.
| Compound Name | (1R,2S,5S,8S)-2-piperidin-1-ium-1-ylbicyclo[3.2.1]octan-8-ol |
|---|---|
| PubChem CID | 11861513 |
| Molecular Formula | C13H24NO+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.19 |
| IUPAC Name | (1R,2S,5S,8S)-2-piperidin-1-ium-1-ylbicyclo[3.2.1]octan-8-ol |
| SMILES | O[C@H]1[C@H]2CC[C@@H]1[C@@H]([NH+]1CCCCC1)CC2 |
| InChI | InChI=1S/C13H23NO/c15-13-10-4-6-11(13)12(7-5-10)14-8-2-1-3-9-14/h10-13,15H,1-9H2/p+1/t10-,11+,12-,13-/m0/s1 |
| InChIKey | OTFFUZVPVSDGHV-RNJOBUHISA-O |
| XLogP | 0.60 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |