C24H26N4O2 — CID 11861522
(1S,4S,9aR)-1-(2,5-diethoxyphenyl)-3-imino-4,6,7,8,9,9a-hexahydro-1H-benzo[7]annulene-2,2,4-tricarbonitrile (PubChem CID 11861522) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (1S,4S,9aR)-1-(2,5-diethoxyphenyl)-3-imino-4,6,7,8,9,9a-hexahydro-1H-benzo[7]annulene-2,2,4-tricarbonitrile.
| Compound Name | (1S,4S,9aR)-1-(2,5-diethoxyphenyl)-3-imino-4,6,7,8,9,9a-hexahydro-1H-benzo[7]annulene-2,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 11861522 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (1S,4S,9aR)-1-(2,5-diethoxyphenyl)-3-imino-4,6,7,8,9,9a-hexahydro-1H-benzo[7]annulene-2,2,4-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCCCC[C@@H]2[C@H](c2cc(OCC)ccc2OCC)C1(C#N)C#N |
| InChI | InChI=1S/C24H26N4O2/c1-3-29-16-10-11-21(30-4-2)19(12-16)22-18-9-7-5-6-8-17(18)20(13-25)23(28)24(22,14-26)15-27/h8,10-12,18,20,22,28H,3-7,9H2,1-2H3/b28-23+/t18-,20-,22+/m0/s1 |
| InChIKey | DVDKZVCQYQTERA-UGZPRJOGSA-N |
| XLogP | 4.89 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|