C31H33N5O7 — CID 118615609
N-tert-butyl-8-(5-carbamoyl-1-oxidopyridin-1-ium-3-yl)-1-(3,5-dimethoxyphenyl)-7-methoxy-N-methyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide (PubChem CID 118615609) has the molecular formula C31H33N5O7 and a molecular weight of 587.63 g/mol. Its IUPAC name is N-tert-butyl-8-(5-carbamoyl-1-oxidopyridin-1-ium-3-yl)-1-(3,5-dimethoxyphenyl)-7-methoxy-N-methyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide.
| Compound Name | N-tert-butyl-8-(5-carbamoyl-1-oxidopyridin-1-ium-3-yl)-1-(3,5-dimethoxyphenyl)-7-methoxy-N-methyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118615609 |
| Molecular Formula | C31H33N5O7 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | N-tert-butyl-8-(5-carbamoyl-1-oxidopyridin-1-ium-3-yl)-1-(3,5-dimethoxyphenyl)-7-methoxy-N-methyl-4H-chromeno[3,4-d]pyrazole-3-carboxamide |
| SMILES | COc1cc(OC)cc(-n2nc(C(=O)N(C)C(C)(C)C)c3c2-c2cc(-c4cc(C(N)=O)c[n+]([O-])c4)c(OC)cc2OC3)c1 |
| InChI | InChI=1S/C31H33N5O7/c1-31(2,3)34(4)30(38)27-24-16-43-26-13-25(42-7)22(17-8-18(29(32)37)15-35(39)14-17)12-23(26)28(24)36(33-27)19-9-20(40-5)11-21(10-19)41-6/h8-15H,16H2,1-7H3,(H2,32,37) |
| InChIKey | BMQNDQOAAACCOT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 145.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|