About N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide
N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide (PubChem CID 118616072) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide.
Molecular Properties
| Compound Name | N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide |
| PubChem CID | 118616072 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide |
| SMILES | C=C/C(=C\C=C(C)C)N(C)C(C)=O |
| InChI | InChI=1S/C11H17NO/c1-6-11(8-7-9(2)3)12(5)10(4)13/h6-8H,1H2,2-5H3/b11-8+ |
| InChIKey | JBQVVSGZPDVJNJ-DHZHZOJOSA-N |
| XLogP | 2.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide?
The IUPAC name of N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide (CID 118616072) is N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide.
What is the SMILES notation for N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide?
The canonical SMILES for N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide is C=C/C(=C\C=C(C)C)N(C)C(C)=O.
What is the InChIKey of N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide?
The InChIKey is JBQVVSGZPDVJNJ-DHZHZOJOSA-N. The full InChI is InChI=1S/C11H17NO/c1-6-11(8-7-9(2)3)12(5)10(4)13/h6-8H,1H2,2-5H3/b11-8+.
What are the key properties of N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide?
N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide has a molecular weight of 179.26 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-[(3E)-6-methylhepta-1,3,5-trien-3-yl]acetamide is sourced from PubChem (CID 118616072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).