About 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole
2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole (PubChem CID 118616219) has the molecular formula C11H11NS
and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole |
| PubChem CID | 118616219 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole |
| SMILES | C=CC(=C)C1=NC2C=CC=CC2S1 |
| InChI | InChI=1S/C11H11NS/c1-3-8(2)11-12-9-6-4-5-7-10(9)13-11/h3-7,9-10H,1-2H2 |
| InChIKey | RECWXDHJEMVFGI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole?
The IUPAC name of 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole (CID 118616219) is 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole.
What is the SMILES notation for 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole?
The canonical SMILES for 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole is C=CC(=C)C1=NC2C=CC=CC2S1.
What is the InChIKey of 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole?
The InChIKey is RECWXDHJEMVFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS/c1-3-8(2)11-12-9-6-4-5-7-10(9)13-11/h3-7,9-10H,1-2H2.
What are the key properties of 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole?
2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole has a molecular weight of 189.28 g/mol, XLogP of 2.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,3-dien-2-yl-3a,7a-dihydro-1,3-benzothiazole is sourced from PubChem (CID 118616219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).