C19H26N2 — CID 118616228
(3Z,5E)-N-[(3Z,5E)-5-ethenylocta-3,5-dien-4-yl]-N'-prop-2-enylidenehexa-3,5-diene-1,6-diimine (PubChem CID 118616228) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is (3Z,5E)-N-[(3Z,5E)-5-ethenylocta-3,5-dien-4-yl]-N'-prop-2-enylidenehexa-3,5-diene-1,6-diimine.
| Compound Name | (3Z,5E)-N-[(3Z,5E)-5-ethenylocta-3,5-dien-4-yl]-N'-prop-2-enylidenehexa-3,5-diene-1,6-diimine |
|---|---|
| PubChem CID | 118616228 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (3Z,5E)-N-[(3Z,5E)-5-ethenylocta-3,5-dien-4-yl]-N'-prop-2-enylidenehexa-3,5-diene-1,6-diimine |
| SMILES | C=C/C=N/C=C/C=C\C/C=N/C(=CCC)/C(C=C)=C/CC |
| InChI | InChI=1S/C19H26N2/c1-5-13-18(8-4)19(14-6-2)21-17-12-10-9-11-16-20-15-7-3/h7-11,13-17H,3-6,12H2,1-2H3/b10-9-,16-11+,18-13+,19-14-,20-15+,21-17+ |
| InChIKey | MTGLFXPMLQUNSG-IBCLYRSNSA-N |
| XLogP | 5.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|