C18H31N — CID 118616229
(2E)-2-ethenyl-N-[(Z)-hex-3-en-2-yl]-N,6-dimethylocta-2,7-dien-1-amine (PubChem CID 118616229) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is (2E)-2-ethenyl-N-[(Z)-hex-3-en-2-yl]-N,6-dimethylocta-2,7-dien-1-amine.
| Compound Name | (2E)-2-ethenyl-N-[(Z)-hex-3-en-2-yl]-N,6-dimethylocta-2,7-dien-1-amine |
|---|---|
| PubChem CID | 118616229 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | (2E)-2-ethenyl-N-[(Z)-hex-3-en-2-yl]-N,6-dimethylocta-2,7-dien-1-amine |
| SMILES | C=C/C(=C\CCC(C)C=C)CN(C)C(C)/C=C\CC |
| InChI | InChI=1S/C18H31N/c1-7-10-13-17(5)19(6)15-18(9-3)14-11-12-16(4)8-2/h8-10,13-14,16-17H,2-3,7,11-12,15H2,1,4-6H3/b13-10-,18-14+ |
| InChIKey | KJVSJHDPHJIHRU-JBFGZICXSA-N |
| XLogP | 4.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|