C18H17N5S — CID 11861626
(5S,8R,8aR)-6-imino-2-methyl-8-(5-methylthiophen-2-yl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile (PubChem CID 11861626) has the molecular formula C18H17N5S and a molecular weight of 335.44 g/mol. Its IUPAC name is (5S,8R,8aR)-6-imino-2-methyl-8-(5-methylthiophen-2-yl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile.
| Compound Name | (5S,8R,8aR)-6-imino-2-methyl-8-(5-methylthiophen-2-yl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
|---|---|
| PubChem CID | 11861626 |
| Molecular Formula | C18H17N5S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (5S,8R,8aR)-6-imino-2-methyl-8-(5-methylthiophen-2-yl)-3,5,8,8a-tetrahydro-1H-isoquinoline-5,7,7-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCN(C)C[C@@H]2[C@@H](c2ccc(C)s2)C1(C#N)C#N |
| InChI | InChI=1S/C18H17N5S/c1-11-3-4-15(24-11)16-14-8-23(2)6-5-12(14)13(7-19)17(22)18(16,9-20)10-21/h3-5,13-14,16,22H,6,8H2,1-2H3/b22-17+/t13-,14-,16-/m0/s1 |
| InChIKey | QDEQZNYCVDRDAG-AWFBSFIMSA-N |
| XLogP | 2.83 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|