C10H15N — CID 118616451
N-[(3Z,5E)-5-ethylhepta-1,3,5-trien-4-yl]methanimine (PubChem CID 118616451) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-[(3Z,5E)-5-ethylhepta-1,3,5-trien-4-yl]methanimine.
| Compound Name | N-[(3Z,5E)-5-ethylhepta-1,3,5-trien-4-yl]methanimine |
|---|---|
| PubChem CID | 118616451 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-[(3Z,5E)-5-ethylhepta-1,3,5-trien-4-yl]methanimine |
| SMILES | C=C/C=C(N=C)/C(=C/C)CC |
| InChI | InChI=1S/C10H15N/c1-5-8-10(11-4)9(6-2)7-3/h5-6,8H,1,4,7H2,2-3H3/b9-6+,10-8- |
| InChIKey | JIFKLQQCONNMHX-BXXMFMFASA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|