About (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine
(Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine (PubChem CID 118616722) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine.
Molecular Properties
| Compound Name | (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine |
| PubChem CID | 118616722 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine |
| SMILES | CCN(C)CC/C(=C/SC)NC |
| InChI | InChI=1S/C9H20N2S/c1-5-11(3)7-6-9(10-2)8-12-4/h8,10H,5-7H2,1-4H3/b9-8- |
| InChIKey | MSPUIATZUTXZKF-HJWRWDBZSA-N |
| XLogP | 1.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine?
The IUPAC name of (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine (CID 118616722) is (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine.
What is the SMILES notation for (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine?
The canonical SMILES for (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine is CCN(C)CC/C(=C/SC)NC.
What is the InChIKey of (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine?
The InChIKey is MSPUIATZUTXZKF-HJWRWDBZSA-N. The full InChI is InChI=1S/C9H20N2S/c1-5-11(3)7-6-9(10-2)8-12-4/h8,10H,5-7H2,1-4H3/b9-8-.
What are the key properties of (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine?
(Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine has a molecular weight of 188.34 g/mol, XLogP of 1.75, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-N-ethyl-1-N,3-N-dimethyl-4-methylsulfanylbut-3-ene-1,3-diamine is sourced from PubChem (CID 118616722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).